C20H28N2O2 — CID 69268975
tert-butyl 4-indol-1-yl-2,6-dimethylpiperidine-1-carboxylate (PubChem CID 69268975) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is tert-butyl 4-indol-1-yl-2,6-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-indol-1-yl-2,6-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 69268975 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl 4-indol-1-yl-2,6-dimethylpiperidine-1-carboxylate |
| SMILES | CC1CC(n2ccc3ccccc32)CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28N2O2/c1-14-12-17(21-11-10-16-8-6-7-9-18(16)21)13-15(2)22(14)19(23)24-20(3,4)5/h6-11,14-15,17H,12-13H2,1-5H3 |
| InChIKey | RMBXFWPWUQICEP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |