C32H24N7O6P3 — CID 101450386
4,4,6,6-tetrapyridin-2-yloxyspiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,6'-benzo[d][1,3,2]benzodioxaphosphepine] (PubChem CID 101450386) has the molecular formula C32H24N7O6P3 and a molecular weight of 695.51 g/mol. Its IUPAC name is 4,4,6,6-tetrapyridin-2-yloxyspiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,6'-benzo[d][1,3,2]benzodioxaphosphepine].
| Compound Name | 4,4,6,6-tetrapyridin-2-yloxyspiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,6'-benzo[d][1,3,2]benzodioxaphosphepine] |
|---|---|
| PubChem CID | 101450386 |
| Molecular Formula | C32H24N7O6P3 |
| Molecular Weight | 695.51 g/mol |
| Exact Mass | 695.10 |
| IUPAC Name | 4,4,6,6-tetrapyridin-2-yloxyspiro[1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,6'-benzo[d][1,3,2]benzodioxaphosphepine] |
| SMILES | c1ccc(OP2(Oc3ccccn3)=NP(Oc3ccccn3)(Oc3ccccn3)=NP3(=N2)Oc2ccccc2-c2ccccc2O3)nc1 |
| InChI | InChI=1S/C32H24N7O6P3/c1-3-15-27-25(13-1)26-14-2-4-16-28(26)41-46(40-27)37-47(42-29-17-5-9-21-33-29,43-30-18-6-10-22-34-30)39-48(38-46,44-31-19-7-11-23-35-31)45-32-20-8-12-24-36-32/h1-24H |
| InChIKey | FOTSOGQPRYAUER-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 144.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.51 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|