C36H36N9O6P3 — CID 91201021
1,2,2,4,5,6-hexakis[(4-methyl-2-pyridinyl)oxy]-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene (PubChem CID 91201021) has the molecular formula C36H36N9O6P3 and a molecular weight of 783.66 g/mol. Its IUPAC name is 1,2,2,4,5,6-hexakis[(4-methyl-2-pyridinyl)oxy]-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene.
| Compound Name | 1,2,2,4,5,6-hexakis[(4-methyl-2-pyridinyl)oxy]-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene |
|---|---|
| PubChem CID | 91201021 |
| Molecular Formula | C36H36N9O6P3 |
| Molecular Weight | 783.66 g/mol |
| Exact Mass | 783.20 |
| IUPAC Name | 1,2,2,4,5,6-hexakis[(4-methyl-2-pyridinyl)oxy]-1,3,5-triaza-2λ5,4,6-triphosphacyclohex-2-ene |
| SMILES | Cc1ccnc(ON2P(Oc3cc(C)ccn3)N=P(Oc3cc(C)ccn3)(Oc3cc(C)ccn3)N(Oc3cc(C)ccn3)P2Oc2cc(C)ccn2)c1 |
| InChI | InChI=1S/C36H36N9O6P3/c1-25-7-13-37-31(19-25)46-44-52(48-33-21-27(3)9-15-39-33)43-54(50-35-23-29(5)11-17-41-35,51-36-24-30(6)12-18-42-36)45(47-32-20-26(2)8-14-38-32)53(44)49-34-22-28(4)10-16-40-34/h7-24H,1-6H3 |
| InChIKey | OXYIQCDQLYAPRZ-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 151.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.66 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|