C29H26N4O6P2 — CID 58610995
2-(2-dipyridin-2-yloxyphosphanyloxyphenyl)propan-2-yl dipyridin-2-yl phosphite (PubChem CID 58610995) has the molecular formula C29H26N4O6P2 and a molecular weight of 588.50 g/mol. Its IUPAC name is 2-(2-dipyridin-2-yloxyphosphanyloxyphenyl)propan-2-yl dipyridin-2-yl phosphite.
| Compound Name | 2-(2-dipyridin-2-yloxyphosphanyloxyphenyl)propan-2-yl dipyridin-2-yl phosphite |
|---|---|
| PubChem CID | 58610995 |
| Molecular Formula | C29H26N4O6P2 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 2-(2-dipyridin-2-yloxyphosphanyloxyphenyl)propan-2-yl dipyridin-2-yl phosphite |
| SMILES | CC(C)(OP(Oc1ccccn1)Oc1ccccn1)c1ccccc1OP(Oc1ccccn1)Oc1ccccn1 |
| InChI | InChI=1S/C29H26N4O6P2/c1-29(2,39-41(37-27-17-7-11-21-32-27)38-28-18-8-12-22-33-28)23-13-3-4-14-24(23)34-40(35-25-15-5-9-19-30-25)36-26-16-6-10-20-31-26/h3-22H,1-2H3 |
| InChIKey | XTDJPIFBBDCICV-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 106.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|