C39H31N3O6 — CID 101450604
N-[(2R,6S,8R,12S)-14-(4-methoxyphenyl)-7-methyl-3,5,9,11-tetraoxo-4,10-diphenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide (PubChem CID 101450604) has the molecular formula C39H31N3O6 and a molecular weight of 637.69 g/mol. Its IUPAC name is N-[(2R,6S,8R,12S)-14-(4-methoxyphenyl)-7-methyl-3,5,9,11-tetraoxo-4,10-diphenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide.
| Compound Name | N-[(2R,6S,8R,12S)-14-(4-methoxyphenyl)-7-methyl-3,5,9,11-tetraoxo-4,10-diphenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
|---|---|
| PubChem CID | 101450604 |
| Molecular Formula | C39H31N3O6 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | N-[(2R,6S,8R,12S)-14-(4-methoxyphenyl)-7-methyl-3,5,9,11-tetraoxo-4,10-diphenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
| SMILES | COc1ccc(C2=CC3(NC(=O)c4ccccc4)[C@@H]4C(=O)N(c5ccccc5)C(=O)[C@@H]4C2(C)[C@@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C39H31N3O6/c1-38-28(23-18-20-27(48-2)21-19-23)22-39(40-33(43)24-12-6-3-7-13-24,31-29(38)34(44)41(36(31)46)25-14-8-4-9-15-25)32-30(38)35(45)42(37(32)47)26-16-10-5-11-17-26/h3-22,29-32H,1-2H3,(H,40,43)/t29-,30+,31+,32-,38?,39? |
| InChIKey | XFHXBDMGQQWZAS-PCVPHCEMSA-N |
| XLogP | 4.89 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|