C26H27N3O6 — CID 102473869
N-(14-acetyl-4,10-diethyl-7-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl)benzamide (PubChem CID 102473869) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-(14-acetyl-4,10-diethyl-7-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl)benzamide.
| Compound Name | N-(14-acetyl-4,10-diethyl-7-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl)benzamide |
|---|---|
| PubChem CID | 102473869 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-(14-acetyl-4,10-diethyl-7-methyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl)benzamide |
| SMILES | CCN1C(=O)C2C(C1=O)C1(C)C(C(C)=O)=CC2(NC(=O)c2ccccc2)C2C(=O)N(CC)C(=O)C21 |
| InChI | InChI=1S/C26H27N3O6/c1-5-28-21(32)16-18(23(28)34)26(27-20(31)14-10-8-7-9-11-14)12-15(13(3)30)25(16,4)17-19(26)24(35)29(6-2)22(17)33/h7-12,16-19H,5-6H2,1-4H3,(H,27,31) |
| InChIKey | XMSODZNCKZVHML-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|