C22H17NO8 — CID 12022153
N-[(2S,6R,8S,12R)-14-acetyl-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide (PubChem CID 12022153) has the molecular formula C22H17NO8 and a molecular weight of 423.38 g/mol. Its IUPAC name is N-[(2S,6R,8S,12R)-14-acetyl-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide.
| Compound Name | N-[(2S,6R,8S,12R)-14-acetyl-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
|---|---|
| PubChem CID | 12022153 |
| Molecular Formula | C22H17NO8 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[(2S,6R,8S,12R)-14-acetyl-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
| SMILES | CC(=O)C1=CC2(NC(=O)c3ccccc3)[C@@H]3C(=O)OC(=O)[C@@H]3C1(C)[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C22H17NO8/c1-9(24)11-8-22(23-16(25)10-6-4-3-5-7-10)14-12(17(26)30-19(14)28)21(11,2)13-15(22)20(29)31-18(13)27/h3-8,12-15H,1-2H3,(H,23,25)/t12-,13+,14+,15-,21?,22? |
| InChIKey | RVECICDQJJCCSK-WSUJKWHESA-N |
| XLogP | 0.34 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|