C23H15NO8 — CID 12022151
N-[(2S,6R,8S,12R)-7-(furan-2-yl)-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide (PubChem CID 12022151) has the molecular formula C23H15NO8 and a molecular weight of 433.37 g/mol. Its IUPAC name is N-[(2S,6R,8S,12R)-7-(furan-2-yl)-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide.
| Compound Name | N-[(2S,6R,8S,12R)-7-(furan-2-yl)-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
|---|---|
| PubChem CID | 12022151 |
| Molecular Formula | C23H15NO8 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[(2S,6R,8S,12R)-7-(furan-2-yl)-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
| SMILES | O=C(NC12C=CC(c3ccco3)([C@@H]3C(=O)OC(=O)[C@@H]31)[C@H]1C(=O)OC(=O)[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C23H15NO8/c25-17(11-5-2-1-3-6-11)24-23-9-8-22(12-7-4-10-30-12,13-15(23)20(28)31-18(13)26)14-16(23)21(29)32-19(14)27/h1-10,13-16H,(H,24,25)/t13-,14+,15+,16-,22?,23? |
| InChIKey | ULKDZYHBSIRYHD-RIHGVXBZSA-N |
| XLogP | 0.90 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|