C20H15NO7 — CID 12022149
N-[(2S,6R,8S,12R)-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide (PubChem CID 12022149) has the molecular formula C20H15NO7 and a molecular weight of 381.34 g/mol. Its IUPAC name is N-[(2S,6R,8S,12R)-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide.
| Compound Name | N-[(2S,6R,8S,12R)-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
|---|---|
| PubChem CID | 12022149 |
| Molecular Formula | C20H15NO7 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[(2S,6R,8S,12R)-7-methyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
| SMILES | CC12C=CC(NC(=O)c3ccccc3)([C@@H]3C(=O)OC(=O)[C@@H]31)[C@H]1C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C20H15NO7/c1-19-7-8-20(12-10(19)15(23)27-17(12)25,13-11(19)16(24)28-18(13)26)21-14(22)9-5-3-2-4-6-9/h2-8,10-13H,1H3,(H,21,22)/t10-,11+,12+,13-,19?,20? |
| InChIKey | GKOYNDPRSKONLL-CGFKRHKXSA-N |
| XLogP | 0.38 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|