C29H27N3O5 — CID 101434321
N-[(2R,6S,8R,12S)-4,10-diethyl-3,5,9,11-tetraoxo-7-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide (PubChem CID 101434321) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is N-[(2R,6S,8R,12S)-4,10-diethyl-3,5,9,11-tetraoxo-7-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide.
| Compound Name | N-[(2R,6S,8R,12S)-4,10-diethyl-3,5,9,11-tetraoxo-7-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
|---|---|
| PubChem CID | 101434321 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[(2R,6S,8R,12S)-4,10-diethyl-3,5,9,11-tetraoxo-7-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-1-yl]benzamide |
| SMILES | CCN1C(=O)[C@@H]2[C@H](C1=O)C1(NC(=O)c3ccccc3)C=CC2(c2ccccc2)[C@H]2C(=O)N(CC)C(=O)[C@H]21 |
| InChI | InChI=1S/C29H27N3O5/c1-3-31-24(34)19-21(26(31)36)29(30-23(33)17-11-7-5-8-12-17)16-15-28(19,18-13-9-6-10-14-18)20-22(29)27(37)32(4-2)25(20)35/h5-16,19-22H,3-4H2,1-2H3,(H,30,33)/t19-,20+,21+,22-,28?,29? |
| InChIKey | PBCNWGUKVBSNPP-OYOZMUCBSA-N |
| XLogP | 1.92 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|