C21H20N2O3 — CID 98226642
(3aR,6aR)-5-ethyl-2-methyl-3,3-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,4,6-trione (PubChem CID 98226642) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3aR,6aR)-5-ethyl-2-methyl-3,3-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,4,6-trione.
| Compound Name | (3aR,6aR)-5-ethyl-2-methyl-3,3-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,4,6-trione |
|---|---|
| PubChem CID | 98226642 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (3aR,6aR)-5-ethyl-2-methyl-3,3-diphenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,4,6-trione |
| SMILES | CCN1C(=O)[C@H]2C(=O)N(C)C(c3ccccc3)(c3ccccc3)[C@@H]2C1=O |
| InChI | InChI=1S/C21H20N2O3/c1-3-23-19(25)16-17(20(23)26)21(22(2)18(16)24,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16-17H,3H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | XIWFSNBYZJUVSZ-SJORKVTESA-N |
| XLogP | 2.02 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|