C22H19BrF2N2O3 — CID 26479732
(3aR,6aS)-6a-[bromo(difluoro)methyl]-5-ethyl-2-methyl-3,3-diphenyl-3aH-pyrrolo[3,4-c]pyrrole-1,4,6-trione (PubChem CID 26479732) has the molecular formula C22H19BrF2N2O3 and a molecular weight of 477.31 g/mol. Its IUPAC name is (3aR,6aS)-6a-[bromo(difluoro)methyl]-5-ethyl-2-methyl-3,3-diphenyl-3aH-pyrrolo[3,4-c]pyrrole-1,4,6-trione.
| Compound Name | (3aR,6aS)-6a-[bromo(difluoro)methyl]-5-ethyl-2-methyl-3,3-diphenyl-3aH-pyrrolo[3,4-c]pyrrole-1,4,6-trione |
|---|---|
| PubChem CID | 26479732 |
| Molecular Formula | C22H19BrF2N2O3 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (3aR,6aS)-6a-[bromo(difluoro)methyl]-5-ethyl-2-methyl-3,3-diphenyl-3aH-pyrrolo[3,4-c]pyrrole-1,4,6-trione |
| SMILES | CCN1C(=O)[C@H]2C(c3ccccc3)(c3ccccc3)N(C)C(=O)[C@]2(C(F)(F)Br)C1=O |
| InChI | InChI=1S/C22H19BrF2N2O3/c1-3-27-17(28)16-20(19(27)30,22(23,24)25)18(29)26(2)21(16,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,16H,3H2,1-2H3/t16-,20+/m1/s1 |
| InChIKey | SJVPAMRKPNQCGT-UZLBHIALSA-N |
| XLogP | 3.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|