C27H29N3O5 — CID 74962129
N-(13,18-dimethyl-12,14,17,19-tetraoxo-13,18-diazapentacyclo[8.5.5.01,8.011,15.016,20]icos-8-en-10-yl)benzamide (PubChem CID 74962129) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-(13,18-dimethyl-12,14,17,19-tetraoxo-13,18-diazapentacyclo[8.5.5.01,8.011,15.016,20]icos-8-en-10-yl)benzamide.
| Compound Name | N-(13,18-dimethyl-12,14,17,19-tetraoxo-13,18-diazapentacyclo[8.5.5.01,8.011,15.016,20]icos-8-en-10-yl)benzamide |
|---|---|
| PubChem CID | 74962129 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-(13,18-dimethyl-12,14,17,19-tetraoxo-13,18-diazapentacyclo[8.5.5.01,8.011,15.016,20]icos-8-en-10-yl)benzamide |
| SMILES | CN1C(=O)C2C(C1=O)C13CCCCCCC1=CC2(NC(=O)c1ccccc1)C1C(=O)N(C)C(=O)C13 |
| InChI | InChI=1S/C27H29N3O5/c1-29-22(32)17-19(24(29)34)27(28-21(31)15-10-6-5-7-11-15)14-16-12-8-3-4-9-13-26(16,17)18-20(27)25(35)30(2)23(18)33/h5-7,10-11,14,17-20H,3-4,8-9,12-13H2,1-2H3,(H,28,31) |
| InChIKey | FXIVOISBDGFARU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|