C23H22N2O4 — CID 11773704
(13S,17S,18R,22R)-11,15,20-trimethyl-15,20-diazahexacyclo[10.5.5.01,10.04,9.013,17.018,22]docosa-4,6,8,10-tetraene-14,16,19,21-tetrone (PubChem CID 11773704) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (13S,17S,18R,22R)-11,15,20-trimethyl-15,20-diazahexacyclo[10.5.5.01,10.04,9.013,17.018,22]docosa-4,6,8,10-tetraene-14,16,19,21-tetrone.
| Compound Name | (13S,17S,18R,22R)-11,15,20-trimethyl-15,20-diazahexacyclo[10.5.5.01,10.04,9.013,17.018,22]docosa-4,6,8,10-tetraene-14,16,19,21-tetrone |
|---|---|
| PubChem CID | 11773704 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (13S,17S,18R,22R)-11,15,20-trimethyl-15,20-diazahexacyclo[10.5.5.01,10.04,9.013,17.018,22]docosa-4,6,8,10-tetraene-14,16,19,21-tetrone |
| SMILES | CC1=C2c3ccccc3CCC23[C@@H]2C(=O)N(C)C(=O)[C@@H]2C1[C@@H]1C(=O)N(C)C(=O)[C@@H]13 |
| InChI | InChI=1S/C23H22N2O4/c1-10-13-14-17(21(28)24(2)19(14)26)23(18-15(13)20(27)25(3)22(18)29)9-8-11-6-4-5-7-12(11)16(10)23/h4-7,13-15,17-18H,8-9H2,1-3H3/t13?,14-,15+,17+,18-,23? |
| InChIKey | NNLHBGUGDGIOAP-CSTCFODPSA-N |
| XLogP | 1.50 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|