C29H23NO4 — CID 135006210
N-[(3S,4R)-3-benzyl-6-(furan-2-yl)-2-oxo-4-phenyl-4H-pyran-3-yl]benzamide (PubChem CID 135006210) has the molecular formula C29H23NO4 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[(3S,4R)-3-benzyl-6-(furan-2-yl)-2-oxo-4-phenyl-4H-pyran-3-yl]benzamide.
| Compound Name | N-[(3S,4R)-3-benzyl-6-(furan-2-yl)-2-oxo-4-phenyl-4H-pyran-3-yl]benzamide |
|---|---|
| PubChem CID | 135006210 |
| Molecular Formula | C29H23NO4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[(3S,4R)-3-benzyl-6-(furan-2-yl)-2-oxo-4-phenyl-4H-pyran-3-yl]benzamide |
| SMILES | O=C(N[C@]1(Cc2ccccc2)C(=O)OC(c2ccco2)=C[C@@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H23NO4/c31-27(23-15-8-3-9-16-23)30-29(20-21-11-4-1-5-12-21)24(22-13-6-2-7-14-22)19-26(34-28(29)32)25-17-10-18-33-25/h1-19,24H,20H2,(H,30,31)/t24-,29+/m1/s1 |
| InChIKey | YKGKLRGRFYJADV-GIGWZHCTSA-N |
| XLogP | 5.37 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |