C23H19NO3 — CID 102144205
N-[(3S,3aS)-3-benzyl-2-oxo-3aH-cyclohepta[b]furan-3-yl]benzamide (PubChem CID 102144205) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(3S,3aS)-3-benzyl-2-oxo-3aH-cyclohepta[b]furan-3-yl]benzamide.
| Compound Name | N-[(3S,3aS)-3-benzyl-2-oxo-3aH-cyclohepta[b]furan-3-yl]benzamide |
|---|---|
| PubChem CID | 102144205 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[(3S,3aS)-3-benzyl-2-oxo-3aH-cyclohepta[b]furan-3-yl]benzamide |
| SMILES | O=C(N[C@]1(Cc2ccccc2)C(=O)OC2=CC=CC=C[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C23H19NO3/c25-21(18-12-6-2-7-13-18)24-23(16-17-10-4-1-5-11-17)19-14-8-3-9-15-20(19)27-22(23)26/h1-15,19H,16H2,(H,24,25)/t19-,23+/m1/s1 |
| InChIKey | FILSMSCQNAGEAK-XXBNENTESA-N |
| XLogP | 3.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |