C14H14O6 — CID 57100498
3-benzoyl-2,2,5,6-tetrahydroxy-5-methylcyclohex-3-en-1-one (PubChem CID 57100498) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-benzoyl-2,2,5,6-tetrahydroxy-5-methylcyclohex-3-en-1-one.
| Compound Name | 3-benzoyl-2,2,5,6-tetrahydroxy-5-methylcyclohex-3-en-1-one |
|---|---|
| PubChem CID | 57100498 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-benzoyl-2,2,5,6-tetrahydroxy-5-methylcyclohex-3-en-1-one |
| SMILES | CC1(O)C=C(C(=O)c2ccccc2)C(O)(O)C(=O)C1O |
| InChI | InChI=1S/C14H14O6/c1-13(18)7-9(14(19,20)12(17)11(13)16)10(15)8-5-3-2-4-6-8/h2-7,11,16,18-20H,1H3 |
| InChIKey | YCICBRSZDLKBEJ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|