C20H16O7 — CID 57187330
3,5-dibenzoyl-2,5,6,6-tetrahydroxycyclohex-3-en-1-one (PubChem CID 57187330) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is 3,5-dibenzoyl-2,5,6,6-tetrahydroxycyclohex-3-en-1-one.
| Compound Name | 3,5-dibenzoyl-2,5,6,6-tetrahydroxycyclohex-3-en-1-one |
|---|---|
| PubChem CID | 57187330 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3,5-dibenzoyl-2,5,6,6-tetrahydroxycyclohex-3-en-1-one |
| SMILES | O=C(C1=CC(O)(C(=O)c2ccccc2)C(O)(O)C(=O)C1O)c1ccccc1 |
| InChI | InChI=1S/C20H16O7/c21-15(12-7-3-1-4-8-12)14-11-19(25,20(26,27)18(24)16(14)22)17(23)13-9-5-2-6-10-13/h1-11,16,22,25-27H |
| InChIKey | LCCZEQBXPXYGGY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|