C13H13F6NO — CID 101451067
4-benzylimino-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol (PubChem CID 101451067) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 4-benzylimino-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol.
| Compound Name | 4-benzylimino-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 101451067 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-benzylimino-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
| SMILES | C/C(CC(O)(C(F)(F)F)C(F)(F)F)=N\Cc1ccccc1 |
| InChI | InChI=1S/C13H13F6NO/c1-9(20-8-10-5-3-2-4-6-10)7-11(21,12(14,15)16)13(17,18)19/h2-6,21H,7-8H2,1H3/b20-9+ |
| InChIKey | FLXYVABLDLCTHK-AWQFTUOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|