C12H18Cl3NO — CID 101452296
[(2E)-deca-2,9-dienyl] 2,2,2-trichloroethanimidate (PubChem CID 101452296) has the molecular formula C12H18Cl3NO and a molecular weight of 298.64 g/mol. Its IUPAC name is [(2E)-deca-2,9-dienyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2E)-deca-2,9-dienyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 101452296 |
| Molecular Formula | C12H18Cl3NO |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | [(2E)-deca-2,9-dienyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/CCCCCC=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO/c1-2-3-4-5-6-7-8-9-10-17-11(16)12(13,14)15/h2,8-9,16H,1,3-7,10H2/b9-8+,16-11- |
| InChIKey | OLYOJDSFQVTJSY-UVBRKHIMSA-N |
| XLogP | 5.04 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|