C8H11F4NO2 — CID 101452993
ethyl (2S)-2-amino-4-(difluoromethyl)-5,5-difluoropent-3-enoate (PubChem CID 101452993) has the molecular formula C8H11F4NO2 and a molecular weight of 229.17 g/mol. Its IUPAC name is ethyl (2S)-2-amino-4-(difluoromethyl)-5,5-difluoropent-3-enoate.
| Compound Name | ethyl (2S)-2-amino-4-(difluoromethyl)-5,5-difluoropent-3-enoate |
|---|---|
| PubChem CID | 101452993 |
| Molecular Formula | C8H11F4NO2 |
| Molecular Weight | 229.17 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | ethyl (2S)-2-amino-4-(difluoromethyl)-5,5-difluoropent-3-enoate |
| SMILES | CCOC(=O)[C@@H](N)C=C(C(F)F)C(F)F |
| InChI | InChI=1S/C8H11F4NO2/c1-2-15-8(14)5(13)3-4(6(9)10)7(11)12/h3,5-7H,2,13H2,1H3/t5-/m0/s1 |
| InChIKey | GDXWPASKQVFVBA-YFKPBYRVSA-N |
| XLogP | 1.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|