C13H20O2 — CID 101456889
2-[(4-methyl-1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane (PubChem CID 101456889) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-[(4-methyl-1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane.
| Compound Name | 2-[(4-methyl-1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane |
|---|---|
| PubChem CID | 101456889 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-[(4-methyl-1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane |
| SMILES | C=C=CC1(OCC2CO2)CCC(C)CC1 |
| InChI | InChI=1S/C13H20O2/c1-3-6-13(15-10-12-9-14-12)7-4-11(2)5-8-13/h6,11-12H,1,4-5,7-10H2,2H3 |
| InChIKey | NQQBDHKWECRZMB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|