C12H18O2 — CID 101456886
2-[(1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane (PubChem CID 101456886) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-[(1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane.
| Compound Name | 2-[(1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane |
|---|---|
| PubChem CID | 101456886 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-[(1-propa-1,2-dienylcyclohexyl)oxymethyl]oxirane |
| SMILES | C=C=CC1(OCC2CO2)CCCCC1 |
| InChI | InChI=1S/C12H18O2/c1-2-6-12(7-4-3-5-8-12)14-10-11-9-13-11/h6,11H,1,3-5,7-10H2 |
| InChIKey | LNOZLDAJLKLZDV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|