C19H34 — CID 174968799
1-methyl-1-propa-1,2-dienylcyclopentadecane (PubChem CID 174968799) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is 1-methyl-1-propa-1,2-dienylcyclopentadecane.
| Compound Name | 1-methyl-1-propa-1,2-dienylcyclopentadecane |
|---|---|
| PubChem CID | 174968799 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | 1-methyl-1-propa-1,2-dienylcyclopentadecane |
| SMILES | C=C=CC1(C)CCCCCCCCCCCCCC1 |
| InChI | InChI=1S/C19H34/c1-3-16-19(2)17-14-12-10-8-6-4-5-7-9-11-13-15-18-19/h16H,1,4-15,17-18H2,2H3 |
| InChIKey | SPMXVYCZDBJLCG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |