C13H19IO — CID 10734300
cis-(1R,2R)-2-[(Z)-5-iodopent-4-enyl]-2-methyl-1-propa-1,2-dienylcyclobutan-1-ol (PubChem CID 10734300) has the molecular formula C13H19IO and a molecular weight of 318.20 g/mol. Its IUPAC name is cis-(1R,2R)-2-[(Z)-5-iodopent-4-enyl]-2-methyl-1-propa-1,2-dienylcyclobutan-1-ol.
| Compound Name | cis-(1R,2R)-2-[(Z)-5-iodopent-4-enyl]-2-methyl-1-propa-1,2-dienylcyclobutan-1-ol |
|---|---|
| PubChem CID | 10734300 |
| Molecular Formula | C13H19IO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | cis-(1R,2R)-2-[(Z)-5-iodopent-4-enyl]-2-methyl-1-propa-1,2-dienylcyclobutan-1-ol |
| SMILES | C=C=C[C@]1(O)CC[C@@]1(C)CCC/C=C\I |
| InChI | InChI=1S/C13H19IO/c1-3-7-13(15)10-9-12(13,2)8-5-4-6-11-14/h6-7,11,15H,1,4-5,8-10H2,2H3/b11-6-/t12-,13+/m1/s1 |
| InChIKey | GNEWZLLIRMCXPS-CUBYMHMKSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|