C15H22O3 — CID 129011744
methyl (1S,2R,3R)-3-ethenyl-2-hydroxy-2-methyl-1-penta-3,4-dienylcyclopentane-1-carboxylate (PubChem CID 129011744) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (1S,2R,3R)-3-ethenyl-2-hydroxy-2-methyl-1-penta-3,4-dienylcyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2R,3R)-3-ethenyl-2-hydroxy-2-methyl-1-penta-3,4-dienylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 129011744 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (1S,2R,3R)-3-ethenyl-2-hydroxy-2-methyl-1-penta-3,4-dienylcyclopentane-1-carboxylate |
| SMILES | C=C=CCC[C@]1(C(=O)OC)CC[C@H](C=C)[C@@]1(C)O |
| InChI | InChI=1S/C15H22O3/c1-5-7-8-10-15(13(16)18-4)11-9-12(6-2)14(15,3)17/h6-7,12,17H,1-2,8-11H2,3-4H3/t12-,14+,15+/m0/s1 |
| InChIKey | VYQDWSSSRQIPPD-NWANDNLSSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|