C18H28O3 — CID 134963128
methyl (1S,3aR,4S,5S,6aR)-1-but-3-enyl-5-ethenyl-4-ethyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate (PubChem CID 134963128) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is methyl (1S,3aR,4S,5S,6aR)-1-but-3-enyl-5-ethenyl-4-ethyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate.
| Compound Name | methyl (1S,3aR,4S,5S,6aR)-1-but-3-enyl-5-ethenyl-4-ethyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 134963128 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | methyl (1S,3aR,4S,5S,6aR)-1-but-3-enyl-5-ethenyl-4-ethyl-6a-hydroxy-2,3,3a,4,5,6-hexahydropentalene-1-carboxylate |
| SMILES | C=CCC[C@]1(C(=O)OC)CC[C@@H]2[C@@H](CC)[C@H](C=C)C[C@@]21O |
| InChI | InChI=1S/C18H28O3/c1-5-8-10-17(16(19)21-4)11-9-15-14(7-3)13(6-2)12-18(15,17)20/h5-6,13-15,20H,1-2,7-12H2,3-4H3/t13-,14+,15-,17-,18-/m1/s1 |
| InChIKey | JIESGPFOPADDNA-JAPOXJDPSA-N |
| XLogP | 3.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|