C13H5F15O2 — CID 59687219
2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxymethyl]oxirane (PubChem CID 59687219) has the molecular formula C13H5F15O2 and a molecular weight of 478.15 g/mol. Its IUPAC name is 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxymethyl]oxirane.
| Compound Name | 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxymethyl]oxirane |
|---|---|
| PubChem CID | 59687219 |
| Molecular Formula | C13H5F15O2 |
| Molecular Weight | 478.15 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 2-[(2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecafluoro-1-adamantyl)oxymethyl]oxirane |
| SMILES | FC1(F)C2(F)C(F)(F)C3(F)C(F)(F)C1(F)C(F)(F)C(OCC1CO1)(C2(F)F)C3(F)F |
| InChI | InChI=1S/C13H5F15O2/c14-4-8(17,18)5(15)10(21,22)6(16,9(4,19)20)13(27,28)7(11(4,23)24,12(5,25)26)30-2-3-1-29-3/h3H,1-2H2 |
| InChIKey | AOEFNQSGZOOCEU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|