C13H22O4 — CID 174831661
1-ethenoxycyclohexan-1-ol;2-(ethenoxymethyl)oxirane (PubChem CID 174831661) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-ethenoxycyclohexan-1-ol;2-(ethenoxymethyl)oxirane.
| Compound Name | 1-ethenoxycyclohexan-1-ol;2-(ethenoxymethyl)oxirane |
|---|---|
| PubChem CID | 174831661 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-ethenoxycyclohexan-1-ol;2-(ethenoxymethyl)oxirane |
| SMILES | C=COC1(O)CCCCC1.C=COCC1CO1 |
| InChI | InChI=1S/C8H14O2.C5H8O2/c1-2-10-8(9)6-4-3-5-7-8;1-2-6-3-5-4-7-5/h2,9H,1,3-7H2;2,5H,1,3-4H2 |
| InChIKey | BUDYKASVPLJDCQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|