C23H22N2O2S — CID 101459588
ethyl (4E)-2-amino-4-[[4-(dimethylamino)phenyl]methylidene]indeno[2,1-b]thiophene-1-carboxylate (PubChem CID 101459588) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is ethyl (4E)-2-amino-4-[[4-(dimethylamino)phenyl]methylidene]indeno[2,1-b]thiophene-1-carboxylate.
| Compound Name | ethyl (4E)-2-amino-4-[[4-(dimethylamino)phenyl]methylidene]indeno[2,1-b]thiophene-1-carboxylate |
|---|---|
| PubChem CID | 101459588 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | ethyl (4E)-2-amino-4-[[4-(dimethylamino)phenyl]methylidene]indeno[2,1-b]thiophene-1-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1-c1ccccc1/C2=C\c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H22N2O2S/c1-4-27-23(26)20-19-17-8-6-5-7-16(17)18(21(19)28-22(20)24)13-14-9-11-15(12-10-14)25(2)3/h5-13H,4,24H2,1-3H3/b18-13+ |
| InChIKey | RCFHYJCONOSCBL-QGOAFFKASA-N |
| XLogP | 5.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|