C22H22N2O2S — CID 141488063
ethyl (6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-1,3-thiazine-5-carboxylate (PubChem CID 141488063) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is ethyl (6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-1,3-thiazine-5-carboxylate.
| Compound Name | ethyl (6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-1,3-thiazine-5-carboxylate |
|---|---|
| PubChem CID | 141488063 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | ethyl (6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-1,3-thiazine-5-carboxylate |
| SMILES | CCOC(=O)C1=CN=C(c2ccccc2)S/C1=C\c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-4-26-22(25)19-15-23-21(17-8-6-5-7-9-17)27-20(19)14-16-10-12-18(13-11-16)24(2)3/h5-15H,4H2,1-3H3/b20-14- |
| InChIKey | AUJINZOPONKPRP-ZHZULCJRSA-N |
| XLogP | 4.73 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|