C26H24N2O3S — CID 135420258
ethyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate (PubChem CID 135420258) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is ethyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate.
| Compound Name | ethyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135420258 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-naphthalen-1-yliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2ccc(N(C)C)cc2)S/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C26H24N2O3S/c1-4-31-26(30)23-24(29)22(16-17-12-14-19(15-13-17)28(2)3)32-25(23)27-21-11-7-9-18-8-5-6-10-20(18)21/h5-16,29H,4H2,1-3H3/b22-16?,27-25- |
| InChIKey | QXLTUSUOXADNJP-HDBDFWNXSA-N |
| XLogP | 6.10 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|