C22H22N2O4S — CID 171136222
methyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-(2-methoxyphenyl)iminothiophene-3-carboxylate (PubChem CID 171136222) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is methyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-(2-methoxyphenyl)iminothiophene-3-carboxylate.
| Compound Name | methyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-(2-methoxyphenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 171136222 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | methyl 5-[[4-(dimethylamino)phenyl]methylidene]-4-hydroxy-2-(2-methoxyphenyl)iminothiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2ccc(N(C)C)cc2)S/C1=N\c1ccccc1OC |
| InChI | InChI=1S/C22H22N2O4S/c1-24(2)15-11-9-14(10-12-15)13-18-20(25)19(22(26)28-4)21(29-18)23-16-7-5-6-8-17(16)27-3/h5-13,25H,1-4H3/b18-13?,23-21- |
| InChIKey | ABGUQYVIOKUJON-DGBSIKRBSA-N |
| XLogP | 4.56 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|