C29H37Br — CID 101461425
7-bromo-2,4-bis(ethenyl)-9,9-dihexylfluorene (PubChem CID 101461425) has the molecular formula C29H37Br and a molecular weight of 465.52 g/mol. Its IUPAC name is 7-bromo-2,4-bis(ethenyl)-9,9-dihexylfluorene.
| Compound Name | 7-bromo-2,4-bis(ethenyl)-9,9-dihexylfluorene |
|---|---|
| PubChem CID | 101461425 |
| Molecular Formula | C29H37Br |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 7-bromo-2,4-bis(ethenyl)-9,9-dihexylfluorene |
| SMILES | C=Cc1cc(C=C)c2c(c1)C(CCCCCC)(CCCCCC)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C29H37Br/c1-5-9-11-13-17-29(18-14-12-10-6-2)26-21-24(30)15-16-25(26)28-23(8-4)19-22(7-3)20-27(28)29/h7-8,15-16,19-21H,3-6,9-14,17-18H2,1-2H3 |
| InChIKey | ZQTHPWUAKCMHLO-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|