C17H16O3 — CID 101461582
1,2,3-trimethoxy-4-(2-phenylethynyl)benzene (PubChem CID 101461582) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4-(2-phenylethynyl)benzene.
| Compound Name | 1,2,3-trimethoxy-4-(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 101461582 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1,2,3-trimethoxy-4-(2-phenylethynyl)benzene |
| SMILES | COc1ccc(C#Cc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C17H16O3/c1-18-15-12-11-14(16(19-2)17(15)20-3)10-9-13-7-5-4-6-8-13/h4-8,11-12H,1-3H3 |
| InChIKey | PFHZYQBGCXTJTQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|