C23H22O5 — CID 11132771
1,2,4,5,8-pentamethoxy-7-(2-phenylethynyl)naphthalene (PubChem CID 11132771) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is 1,2,4,5,8-pentamethoxy-7-(2-phenylethynyl)naphthalene.
| Compound Name | 1,2,4,5,8-pentamethoxy-7-(2-phenylethynyl)naphthalene |
|---|---|
| PubChem CID | 11132771 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1,2,4,5,8-pentamethoxy-7-(2-phenylethynyl)naphthalene |
| SMILES | COc1cc(OC)c2c(OC)cc(C#Cc3ccccc3)c(OC)c2c1OC |
| InChI | InChI=1S/C23H22O5/c1-24-17-13-16(12-11-15-9-7-6-8-10-15)22(27-4)21-20(17)18(25-2)14-19(26-3)23(21)28-5/h6-10,13-14H,1-5H3 |
| InChIKey | SMSKYXNOOVLEHU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|