C22H18O5 — CID 45028146
6-(2-phenylethynyl)-5-(3,4,5-trimethoxyphenyl)pyran-2-one (PubChem CID 45028146) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is 6-(2-phenylethynyl)-5-(3,4,5-trimethoxyphenyl)pyran-2-one.
| Compound Name | 6-(2-phenylethynyl)-5-(3,4,5-trimethoxyphenyl)pyran-2-one |
|---|---|
| PubChem CID | 45028146 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 6-(2-phenylethynyl)-5-(3,4,5-trimethoxyphenyl)pyran-2-one |
| SMILES | COc1cc(-c2ccc(=O)oc2C#Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H18O5/c1-24-19-13-16(14-20(25-2)22(19)26-3)17-10-12-21(23)27-18(17)11-9-15-7-5-4-6-8-15/h4-8,10,12-14H,1-3H3 |
| InChIKey | KBJMQVSEFOSBNW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|