C16H16N2O3 — CID 101462284
7-(3,5-dimethoxyphenyl)-1-methyl-6-oxidopyrrolo[2,3-c]pyridin-6-ium (PubChem CID 101462284) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 7-(3,5-dimethoxyphenyl)-1-methyl-6-oxidopyrrolo[2,3-c]pyridin-6-ium.
| Compound Name | 7-(3,5-dimethoxyphenyl)-1-methyl-6-oxidopyrrolo[2,3-c]pyridin-6-ium |
|---|---|
| PubChem CID | 101462284 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 7-(3,5-dimethoxyphenyl)-1-methyl-6-oxidopyrrolo[2,3-c]pyridin-6-ium |
| SMILES | COc1cc(OC)cc(-c2c3c(ccn3C)cc[n+]2[O-])c1 |
| InChI | InChI=1S/C16H16N2O3/c1-17-6-4-11-5-7-18(19)16(15(11)17)12-8-13(20-2)10-14(9-12)21-3/h4-10H,1-3H3 |
| InChIKey | GOGZUJBZPUHBKR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|