C10H12N2O2 — CID 96624254
5,7-dimethoxyindol-1-amine (PubChem CID 96624254) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5,7-dimethoxyindol-1-amine.
| Compound Name | 5,7-dimethoxyindol-1-amine |
|---|---|
| PubChem CID | 96624254 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5,7-dimethoxyindol-1-amine |
| SMILES | COc1cc(OC)c2c(ccn2N)c1 |
| InChI | InChI=1S/C10H12N2O2/c1-13-8-5-7-3-4-12(11)10(7)9(6-8)14-2/h3-6H,11H2,1-2H3 |
| InChIKey | QZMLIQPBSUUIER-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |