C16H22N2O2 — CID 162388725
3-(5,7-dimethoxyindol-1-yl)-N,N-dimethylcyclobutan-1-amine (PubChem CID 162388725) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-(5,7-dimethoxyindol-1-yl)-N,N-dimethylcyclobutan-1-amine.
| Compound Name | 3-(5,7-dimethoxyindol-1-yl)-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 162388725 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-(5,7-dimethoxyindol-1-yl)-N,N-dimethylcyclobutan-1-amine |
| SMILES | COc1cc(OC)c2c(ccn2C2CC(N(C)C)C2)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-17(2)12-8-13(9-12)18-6-5-11-7-14(19-3)10-15(20-4)16(11)18/h5-7,10,12-13H,8-9H2,1-4H3 |
| InChIKey | CQGKFPUWZMUIFF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |