C12H16N2O2 — CID 82494071
2-(5,7-dimethoxyindol-1-yl)ethanamine (PubChem CID 82494071) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(5,7-dimethoxyindol-1-yl)ethanamine.
| Compound Name | 2-(5,7-dimethoxyindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 82494071 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(5,7-dimethoxyindol-1-yl)ethanamine |
| SMILES | COc1cc(OC)c2c(ccn2CCN)c1 |
| InChI | InChI=1S/C12H16N2O2/c1-15-10-7-9-3-5-14(6-4-13)12(9)11(8-10)16-2/h3,5,7-8H,4,6,13H2,1-2H3 |
| InChIKey | GAONEYPPOXJUKS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |