About 5-methoxyindol-1-amine;5-methoxy-1H-indole
5-methoxyindol-1-amine;5-methoxy-1H-indole (PubChem CID 160670246) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is 5-methoxyindol-1-amine;5-methoxy-1H-indole.
Molecular Properties
| Compound Name | 5-methoxyindol-1-amine;5-methoxy-1H-indole |
| PubChem CID | 160670246 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-methoxyindol-1-amine;5-methoxy-1H-indole |
| SMILES | COc1ccc2[nH]ccc2c1.COc1ccc2c(ccn2N)c1 |
| InChI | InChI=1S/C9H10N2O.C9H9NO/c1-12-8-2-3-9-7(6-8)4-5-11(9)10;1-11-8-2-3-9-7(6-8)4-5-10-9/h2-6H,10H2,1H3;2-6,10H,1H3 |
| InChIKey | RMVJWZXAIBRFSJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxyindol-1-amine;5-methoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyindol-1-amine;5-methoxy-1H-indole?
The IUPAC name of 5-methoxyindol-1-amine;5-methoxy-1H-indole (CID 160670246) is 5-methoxyindol-1-amine;5-methoxy-1H-indole.
What is the SMILES notation for 5-methoxyindol-1-amine;5-methoxy-1H-indole?
The canonical SMILES for 5-methoxyindol-1-amine;5-methoxy-1H-indole is COc1ccc2[nH]ccc2c1.COc1ccc2c(ccn2N)c1.
What is the InChIKey of 5-methoxyindol-1-amine;5-methoxy-1H-indole?
The InChIKey is RMVJWZXAIBRFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O.C9H9NO/c1-12-8-2-3-9-7(6-8)4-5-11(9)10;1-11-8-2-3-9-7(6-8)4-5-10-9/h2-6H,10H2,1H3;2-6,10H,1H3.
What are the key properties of 5-methoxyindol-1-amine;5-methoxy-1H-indole?
5-methoxyindol-1-amine;5-methoxy-1H-indole has a molecular weight of 309.37 g/mol, XLogP of 3.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyindol-1-amine;5-methoxy-1H-indole is sourced from PubChem (CID 160670246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).