C12H18O7 — CID 101463874
CID 101463874 (PubChem CID 101463874) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol.
| Compound Name | CID 101463874 |
|---|---|
| PubChem CID | 101463874 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | — |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@]3(COC(C)(C)O3)C23OO3)O1 |
| InChI | InChI=1S/C12H18O7/c1-9(2)14-6-11(17-9)12(18-19-12)8-7(5-13-11)15-10(3,4)16-8/h7-8H,5-6H2,1-4H3/t7-,8-,11+/m1/s1 |
| InChIKey | RKGHZLBNDVJOOL-XLDPMVHQSA-N |
| XLogP | 0.67 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|