C17H18N2O6Se — CID 101465416
1-[(3aR,4R,6S,6aS)-2-methoxy-6-(phenylselanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione (PubChem CID 101465416) has the molecular formula C17H18N2O6Se and a molecular weight of 425.30 g/mol. Its IUPAC name is 1-[(3aR,4R,6S,6aS)-2-methoxy-6-(phenylselanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6S,6aS)-2-methoxy-6-(phenylselanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101465416 |
| Molecular Formula | C17H18N2O6Se |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 1-[(3aR,4R,6S,6aS)-2-methoxy-6-(phenylselanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
| SMILES | COC1O[C@@H]2[C@H](O1)[C@@H](C[Se]c1ccccc1)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N2O6Se/c1-22-17-24-13-11(9-26-10-5-3-2-4-6-10)23-15(14(13)25-17)19-8-7-12(20)18-16(19)21/h2-8,11,13-15,17H,9H2,1H3,(H,18,20,21)/t11-,13-,14-,15-,17?/m1/s1 |
| InChIKey | PENIBOYBGLKTEJ-WMSQIARESA-N |
| XLogP | -0.40 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|