C11H19NO4 — CID 101466000
tert-butyl N-hydroxy-N-[(1S,2R)-2-methoxycyclopent-3-en-1-yl]carbamate (PubChem CID 101466000) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is tert-butyl N-hydroxy-N-[(1S,2R)-2-methoxycyclopent-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-hydroxy-N-[(1S,2R)-2-methoxycyclopent-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 101466000 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | tert-butyl N-hydroxy-N-[(1S,2R)-2-methoxycyclopent-3-en-1-yl]carbamate |
| SMILES | CO[C@@H]1C=CC[C@@H]1N(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(13)12(14)8-6-5-7-9(8)15-4/h5,7-9,14H,6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | RTFRXGIDBDMMHL-DTWKUNHWSA-N |
| XLogP | 1.96 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|