C12H21NO4 — CID 42642820
tert-butyl N-[(1S,2R)-2-ethoxycyclopent-3-en-1-yl]-N-hydroxycarbamate (PubChem CID 42642820) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-ethoxycyclopent-3-en-1-yl]-N-hydroxycarbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-ethoxycyclopent-3-en-1-yl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 42642820 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-ethoxycyclopent-3-en-1-yl]-N-hydroxycarbamate |
| SMILES | CCO[C@@H]1C=CC[C@@H]1N(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO4/c1-5-16-10-8-6-7-9(10)13(15)11(14)17-12(2,3)4/h6,8-10,15H,5,7H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | CGGDXDYUUMLRTA-VHSXEESVSA-N |
| XLogP | 2.35 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|