C12H16N2O4S — CID 101472556
1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoazaniumylideneethenolate (PubChem CID 101472556) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoazaniumylideneethenolate.
| Compound Name | 1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoazaniumylideneethenolate |
|---|---|
| PubChem CID | 101472556 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoazaniumylideneethenolate |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C([O-])=C=[N+]=O)[C@@H]3C2 |
| InChI | InChI=1S/C12H16N2O4S/c1-11(2)8-3-4-12(11)7-19(17,18)14(9(12)5-8)10(15)6-13-16/h8-9H,3-5,7H2,1-2H3/t8-,9-,12-/m1/s1 |
| InChIKey | SVIBXGIAEYZOFA-KBVBSXBZSA-N |
| XLogP | -0.47 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|