C27H28SSi — CID 101476212
trimethyl-[2-methyl-1-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)prop-1-enyl]sulfanylsilane (PubChem CID 101476212) has the molecular formula C27H28SSi and a molecular weight of 412.67 g/mol. Its IUPAC name is trimethyl-[2-methyl-1-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)prop-1-enyl]sulfanylsilane.
| Compound Name | trimethyl-[2-methyl-1-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)prop-1-enyl]sulfanylsilane |
|---|---|
| PubChem CID | 101476212 |
| Molecular Formula | C27H28SSi |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | trimethyl-[2-methyl-1-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)prop-1-enyl]sulfanylsilane |
| SMILES | CC(C)=C(S[Si](C)(C)C)C12c3ccccc3C(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C27H28SSi/c1-18(2)26(28-29(3,4)5)27-22-15-9-6-12-19(22)25(20-13-7-10-16-23(20)27)21-14-8-11-17-24(21)27/h6-17,25H,1-5H3 |
| InChIKey | KUUNNVSBBMWOQY-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|