C26H24O2Si — CID 102465210
methyl (E)-3-[dimethyl(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)silyl]prop-2-enoate (PubChem CID 102465210) has the molecular formula C26H24O2Si and a molecular weight of 396.56 g/mol. Its IUPAC name is methyl (E)-3-[dimethyl(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)silyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[dimethyl(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)silyl]prop-2-enoate |
|---|---|
| PubChem CID | 102465210 |
| Molecular Formula | C26H24O2Si |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl (E)-3-[dimethyl(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)silyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[Si](C)(C)C12c3ccccc3C(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C26H24O2Si/c1-28-24(27)16-17-29(2,3)26-21-13-7-4-10-18(21)25(19-11-5-8-14-22(19)26)20-12-6-9-15-23(20)26/h4-17,25H,1-3H3/b17-16+ |
| InChIKey | GLMXBRGUCVBGIA-WUKNDPDISA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|