methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate

C20H16N2O2 — CID 101478754

IUPACmethyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate
SMILESCOC(=O)C1=Cc2cc3ccccc3nc2N(c2ccccc2)C1
InChIInChI=1S/C20H16N2O2/c1-24-20(23)16-12-15-11-14-7-5-6-10-18(14)21-19(15)22(13-16)17-8-3-2-4-9-17/h2-12H,13H2,1H3
InChIKeyNCSAATJPKGGICW-UHFFFAOYSA-N
MW316.36 g/mol
LogP3.94
Rot. Bonds2

About methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate

methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate (PubChem CID 101478754) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate
PubChem CID101478754
Molecular FormulaC20H16N2O2
Molecular Weight316.36 g/mol
Exact Mass316.12
IUPAC Namemethyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate
SMILESCOC(=O)C1=Cc2cc3ccccc3nc2N(c2ccccc2)C1
InChIInChI=1S/C20H16N2O2/c1-24-20(23)16-12-15-11-14-7-5-6-10-18(14)21-19(15)22(13-16)17-8-3-2-4-9-17/h2-12H,13H2,1H3
InChIKeyNCSAATJPKGGICW-UHFFFAOYSA-N
XLogP3.94
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.36
LogP ≤ 53.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate?
The IUPAC name of methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate (CID 101478754) is methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate.
What is the SMILES notation for methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate?
The canonical SMILES for methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate is COC(=O)C1=Cc2cc3ccccc3nc2N(c2ccccc2)C1.
What is the InChIKey of methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate?
The InChIKey is NCSAATJPKGGICW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O2/c1-24-20(23)16-12-15-11-14-7-5-6-10-18(14)21-19(15)22(13-16)17-8-3-2-4-9-17/h2-12H,13H2,1H3.
What are the key properties of methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate?
methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate has a molecular weight of 316.36 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-phenyl-2H-benzo[b][1,8]naphthyridine-3-carboxylate is sourced from PubChem (CID 101478754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).